C11H11ClFNO3 — CID 114899828
3-amino-2-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-oxopropanoic acid (PubChem CID 114899828) has the molecular formula C11H11ClFNO3 and a molecular weight of 259.66 g/mol. Its IUPAC name is 3-amino-2-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-amino-2-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114899828 |
| Molecular Formula | C11H11ClFNO3 |
| Molecular Weight | 259.66 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 3-amino-2-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(Cc1c(F)cccc1Cl)(C(N)=O)C(=O)O |
| InChI | InChI=1S/C11H11ClFNO3/c1-11(9(14)15,10(16)17)5-6-7(12)3-2-4-8(6)13/h2-4H,5H2,1H3,(H2,14,15)(H,16,17) |
| InChIKey | IPGYFYCHHGLDPQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.66 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|