About 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate
3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate (PubChem CID 175380469) has the molecular formula C12H13Cl2NO4
and a molecular weight of 306.14 g/mol. Its IUPAC name is 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate.
Molecular Properties
| Compound Name | 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate |
| PubChem CID | 175380469 |
| Molecular Formula | C12H13Cl2NO4 |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate |
| SMILES | NC(CCl)(C(=O)OCCl)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H13Cl2NO4/c13-7-12(15,11(17)19-8-14)10(16)18-6-9-4-2-1-3-5-9/h1-5H,6-8,15H2 |
| InChIKey | APABGFMUCJVXEP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate?
The IUPAC name of 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate (CID 175380469) is 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate.
What is the SMILES notation for 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate?
The canonical SMILES for 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate is NC(CCl)(C(=O)OCCl)C(=O)OCc1ccccc1.
What is the InChIKey of 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate?
The InChIKey is APABGFMUCJVXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2NO4/c13-7-12(15,11(17)19-8-14)10(16)18-6-9-4-2-1-3-5-9/h1-5H,6-8,15H2.
What are the key properties of 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate?
3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate has a molecular weight of 306.14 g/mol, XLogP of 1.41, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-benzyl 1-O-(chloromethyl) 2-amino-2-(chloromethyl)propanedioate is sourced from PubChem (CID 175380469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).