C14H13Cl2N3O2S2 — CID 1294848
1-benzyl-3-[(2,5-dichlorophenyl)sulfonylamino]thiourea (PubChem CID 1294848) has the molecular formula C14H13Cl2N3O2S2 and a molecular weight of 390.32 g/mol. Its IUPAC name is 1-benzyl-3-[(2,5-dichlorophenyl)sulfonylamino]thiourea.
| Compound Name | 1-benzyl-3-[(2,5-dichlorophenyl)sulfonylamino]thiourea |
|---|---|
| PubChem CID | 1294848 |
| Molecular Formula | C14H13Cl2N3O2S2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 1-benzyl-3-[(2,5-dichlorophenyl)sulfonylamino]thiourea |
| SMILES | O=S(=O)(NNC(=S)NCc1ccccc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2N3O2S2/c15-11-6-7-12(16)13(8-11)23(20,21)19-18-14(22)17-9-10-4-2-1-3-5-10/h1-8,19H,9H2,(H2,17,18,22) |
| InChIKey | CDYCULNIIJBALY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|