C15H15ClN2O3S2 — CID 118729553
1-benzyl-3-(5-chloro-2-methoxyphenyl)sulfonylthiourea (PubChem CID 118729553) has the molecular formula C15H15ClN2O3S2 and a molecular weight of 370.88 g/mol. Its IUPAC name is 1-benzyl-3-(5-chloro-2-methoxyphenyl)sulfonylthiourea.
| Compound Name | 1-benzyl-3-(5-chloro-2-methoxyphenyl)sulfonylthiourea |
|---|---|
| PubChem CID | 118729553 |
| Molecular Formula | C15H15ClN2O3S2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 1-benzyl-3-(5-chloro-2-methoxyphenyl)sulfonylthiourea |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C15H15ClN2O3S2/c1-21-13-8-7-12(16)9-14(13)23(19,20)18-15(22)17-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H2,17,18,22) |
| InChIKey | PWFRQPYAGDSRAV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|