C19H23ClN3NaO5S2 — CID 173125954
sodium;5-chloro-2-methoxy-N-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]benzamide;hydride (PubChem CID 173125954) has the molecular formula C19H23ClN3NaO5S2 and a molecular weight of 495.99 g/mol. Its IUPAC name is sodium;5-chloro-2-methoxy-N-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]benzamide;hydride.
| Compound Name | sodium;5-chloro-2-methoxy-N-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]benzamide;hydride |
|---|---|
| PubChem CID | 173125954 |
| Molecular Formula | C19H23ClN3NaO5S2 |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | sodium;5-chloro-2-methoxy-N-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]benzamide;hydride |
| SMILES | CNC(=S)NS(=O)(=O)c1cc(CCNC(=O)c2cc(Cl)ccc2OC)ccc1OC.[H-].[Na+] |
| InChI | InChI=1S/C19H22ClN3O5S2.Na.H/c1-21-19(29)23-30(25,26)17-10-12(4-6-16(17)28-3)8-9-22-18(24)14-11-13(20)5-7-15(14)27-2;;/h4-7,10-11H,8-9H2,1-3H3,(H,22,24)(H2,21,23,29);;/q;+1;-1 |
| InChIKey | AQZPBDHYMYBPJO-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|