C18H17ClN2O4S — CID 10500755
5-chloro-N-[2-(4-ethynyl-3-sulfamoylphenyl)ethyl]-2-methoxybenzamide (PubChem CID 10500755) has the molecular formula C18H17ClN2O4S and a molecular weight of 392.86 g/mol. Its IUPAC name is 5-chloro-N-[2-(4-ethynyl-3-sulfamoylphenyl)ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-(4-ethynyl-3-sulfamoylphenyl)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 10500755 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 5-chloro-N-[2-(4-ethynyl-3-sulfamoylphenyl)ethyl]-2-methoxybenzamide |
| SMILES | C#Cc1ccc(CCNC(=O)c2cc(Cl)ccc2OC)cc1S(N)(=O)=O |
| InChI | InChI=1S/C18H17ClN2O4S/c1-3-13-5-4-12(10-17(13)26(20,23)24)8-9-21-18(22)15-11-14(19)6-7-16(15)25-2/h1,4-7,10-11H,8-9H2,2H3,(H,21,22)(H2,20,23,24) |
| InChIKey | IGRRXVLMSWMJKF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|