C20H24ClN3O5S2 — CID 20721296
5-chloro-2-methoxy-N-[2-[4-methoxy-3-[methyl(methylcarbamothioyl)sulfamoyl]phenyl]ethyl]benzamide (PubChem CID 20721296) has the molecular formula C20H24ClN3O5S2 and a molecular weight of 486.02 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[2-[4-methoxy-3-[methyl(methylcarbamothioyl)sulfamoyl]phenyl]ethyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[2-[4-methoxy-3-[methyl(methylcarbamothioyl)sulfamoyl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 20721296 |
| Molecular Formula | C20H24ClN3O5S2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 5-chloro-2-methoxy-N-[2-[4-methoxy-3-[methyl(methylcarbamothioyl)sulfamoyl]phenyl]ethyl]benzamide |
| SMILES | CNC(=S)N(C)S(=O)(=O)c1cc(CCNC(=O)c2cc(Cl)ccc2OC)ccc1OC |
| InChI | InChI=1S/C20H24ClN3O5S2/c1-22-20(30)24(2)31(26,27)18-11-13(5-7-17(18)29-4)9-10-23-19(25)15-12-14(21)6-8-16(15)28-3/h5-8,11-12H,9-10H2,1-4H3,(H,22,30)(H,23,25) |
| InChIKey | WXOJFGQYLHCFJO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|