C23H23ClN4O4S2 — CID 10553956
5-chloro-2-methoxy-N-[2-[3-(methylcarbamothioylsulfamoyl)-4-pyridin-3-ylphenyl]ethyl]benzamide (PubChem CID 10553956) has the molecular formula C23H23ClN4O4S2 and a molecular weight of 519.05 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[2-[3-(methylcarbamothioylsulfamoyl)-4-pyridin-3-ylphenyl]ethyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[2-[3-(methylcarbamothioylsulfamoyl)-4-pyridin-3-ylphenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 10553956 |
| Molecular Formula | C23H23ClN4O4S2 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 5-chloro-2-methoxy-N-[2-[3-(methylcarbamothioylsulfamoyl)-4-pyridin-3-ylphenyl]ethyl]benzamide |
| SMILES | CNC(=S)NS(=O)(=O)c1cc(CCNC(=O)c2cc(Cl)ccc2OC)ccc1-c1cccnc1 |
| InChI | InChI=1S/C23H23ClN4O4S2/c1-25-23(33)28-34(30,31)21-12-15(5-7-18(21)16-4-3-10-26-14-16)9-11-27-22(29)19-13-17(24)6-8-20(19)32-2/h3-8,10,12-14H,9,11H2,1-2H3,(H,27,29)(H2,25,28,33) |
| InChIKey | VCRUNBGAELNLJL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|