C24H24ClN3O5S3 — CID 18476520
S-(methylamino) N-[5-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-phenylsulfanylphenyl]sulfonylcarbamothioate (PubChem CID 18476520) has the molecular formula C24H24ClN3O5S3 and a molecular weight of 566.13 g/mol. Its IUPAC name is S-(methylamino) N-[5-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-phenylsulfanylphenyl]sulfonylcarbamothioate.
| Compound Name | S-(methylamino) N-[5-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-phenylsulfanylphenyl]sulfonylcarbamothioate |
|---|---|
| PubChem CID | 18476520 |
| Molecular Formula | C24H24ClN3O5S3 |
| Molecular Weight | 566.13 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | S-(methylamino) N-[5-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-phenylsulfanylphenyl]sulfonylcarbamothioate |
| SMILES | CNSC(=O)NS(=O)(=O)c1cc(CCNC(=O)c2cc(Cl)ccc2OC)ccc1Sc1ccccc1 |
| InChI | InChI=1S/C24H24ClN3O5S3/c1-26-35-24(30)28-36(31,32)22-14-16(8-11-21(22)34-18-6-4-3-5-7-18)12-13-27-23(29)19-15-17(25)9-10-20(19)33-2/h3-11,14-15,26H,12-13H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | RMCMLZIZLAUXIP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.13 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|