C17H17ClF3N3O6S3 — CID 19065194
S-(methylamino) N-[5-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-3-(trifluoromethoxy)thiophen-2-yl]sulfonylcarbamothioate (PubChem CID 19065194) has the molecular formula C17H17ClF3N3O6S3 and a molecular weight of 547.99 g/mol. Its IUPAC name is S-(methylamino) N-[5-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-3-(trifluoromethoxy)thiophen-2-yl]sulfonylcarbamothioate.
| Compound Name | S-(methylamino) N-[5-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-3-(trifluoromethoxy)thiophen-2-yl]sulfonylcarbamothioate |
|---|---|
| PubChem CID | 19065194 |
| Molecular Formula | C17H17ClF3N3O6S3 |
| Molecular Weight | 547.99 g/mol |
| Exact Mass | 546.99 |
| IUPAC Name | S-(methylamino) N-[5-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-3-(trifluoromethoxy)thiophen-2-yl]sulfonylcarbamothioate |
| SMILES | CNSC(=O)NS(=O)(=O)c1sc(CCNC(=O)c2cc(Cl)ccc2OC)cc1OC(F)(F)F |
| InChI | InChI=1S/C17H17ClF3N3O6S3/c1-22-32-16(26)24-33(27,28)15-13(30-17(19,20)21)8-10(31-15)5-6-23-14(25)11-7-9(18)3-4-12(11)29-2/h3-4,7-8,22H,5-6H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | FSWJPEBBOIVGQY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.99 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|