C20H22ClN3O7S2 — CID 22100490
S-(methylamino) N-[[3-[(5-chloro-2-methoxybenzoyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate (PubChem CID 22100490) has the molecular formula C20H22ClN3O7S2 and a molecular weight of 516.00 g/mol. Its IUPAC name is S-(methylamino) N-[[3-[(5-chloro-2-methoxybenzoyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate.
| Compound Name | S-(methylamino) N-[[3-[(5-chloro-2-methoxybenzoyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate |
|---|---|
| PubChem CID | 22100490 |
| Molecular Formula | C20H22ClN3O7S2 |
| Molecular Weight | 516.00 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | S-(methylamino) N-[[3-[(5-chloro-2-methoxybenzoyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate |
| SMILES | CNSC(=O)NS(=O)(=O)c1cc2c(cc1OC)OCC(NC(=O)c1cc(Cl)ccc1OC)C2 |
| InChI | InChI=1S/C20H22ClN3O7S2/c1-22-32-20(26)24-33(27,28)18-7-11-6-13(10-31-16(11)9-17(18)30-3)23-19(25)14-8-12(21)4-5-15(14)29-2/h4-5,7-9,13,22H,6,10H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | MRIVUQWTNVOGAN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.00 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|