C22H26ClN3O7S2 — CID 22100468
S-(propylamino) N-[[3-[(5-chloro-2-methoxybenzoyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate (PubChem CID 22100468) has the molecular formula C22H26ClN3O7S2 and a molecular weight of 544.05 g/mol. Its IUPAC name is S-(propylamino) N-[[3-[(5-chloro-2-methoxybenzoyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate.
| Compound Name | S-(propylamino) N-[[3-[(5-chloro-2-methoxybenzoyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate |
|---|---|
| PubChem CID | 22100468 |
| Molecular Formula | C22H26ClN3O7S2 |
| Molecular Weight | 544.05 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | S-(propylamino) N-[[3-[(5-chloro-2-methoxybenzoyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate |
| SMILES | CCCNSC(=O)NS(=O)(=O)c1cc2c(cc1OC)OCC(NC(=O)c1cc(Cl)ccc1OC)C2 |
| InChI | InChI=1S/C22H26ClN3O7S2/c1-4-7-24-34-22(28)26-35(29,30)20-9-13-8-15(12-33-18(13)11-19(20)32-3)25-21(27)16-10-14(23)5-6-17(16)31-2/h5-6,9-11,15,24H,4,7-8,12H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | VAGDKLUVJWSSPZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.05 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|