C18H22N4O6S2 — CID 22100476
S-(methylamino) N-[[7-ethyl-3-[(5-oxo-2H-pyrrole-1-carbonyl)amino]-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate (PubChem CID 22100476) has the molecular formula C18H22N4O6S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is S-(methylamino) N-[[7-ethyl-3-[(5-oxo-2H-pyrrole-1-carbonyl)amino]-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate.
| Compound Name | S-(methylamino) N-[[7-ethyl-3-[(5-oxo-2H-pyrrole-1-carbonyl)amino]-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate |
|---|---|
| PubChem CID | 22100476 |
| Molecular Formula | C18H22N4O6S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | S-(methylamino) N-[[7-ethyl-3-[(5-oxo-2H-pyrrole-1-carbonyl)amino]-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate |
| SMILES | CCc1cc2c(cc1S(=O)(=O)NC(=O)SNC)CC(NC(=O)N1CC=CC1=O)CO2 |
| InChI | InChI=1S/C18H22N4O6S2/c1-3-11-8-14-12(9-15(11)30(26,27)21-18(25)29-19-2)7-13(10-28-14)20-17(24)22-6-4-5-16(22)23/h4-5,8-9,13,19H,3,6-7,10H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | RGRRGBFZEXJNGB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|