C23H28BrN3O7S2 — CID 18973651
S-(ethylamino) N-[[4-[1-[(5-bromo-2-methoxybenzoyl)amino]ethyl]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate (PubChem CID 18973651) has the molecular formula C23H28BrN3O7S2 and a molecular weight of 602.53 g/mol. Its IUPAC name is S-(ethylamino) N-[[4-[1-[(5-bromo-2-methoxybenzoyl)amino]ethyl]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate.
| Compound Name | S-(ethylamino) N-[[4-[1-[(5-bromo-2-methoxybenzoyl)amino]ethyl]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate |
|---|---|
| PubChem CID | 18973651 |
| Molecular Formula | C23H28BrN3O7S2 |
| Molecular Weight | 602.53 g/mol |
| Exact Mass | 601.06 |
| IUPAC Name | S-(ethylamino) N-[[4-[1-[(5-bromo-2-methoxybenzoyl)amino]ethyl]-7-methoxy-3,4-dihydro-2H-chromen-6-yl]sulfonyl]carbamothioate |
| SMILES | CCNSC(=O)NS(=O)(=O)c1cc2c(cc1OC)OCCC2C(C)NC(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C23H28BrN3O7S2/c1-5-25-35-23(29)27-36(30,31)21-11-16-15(8-9-34-19(16)12-20(21)33-4)13(2)26-22(28)17-10-14(24)6-7-18(17)32-3/h6-7,10-13,15,25H,5,8-9H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | WDMJJXLMYPVDMH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|