C16H14BClFNO2 — CID 89193548
CID 89193548 (PubChem CID 89193548) has the molecular formula C16H14BClFNO2 and a molecular weight of 317.56 g/mol.
| Compound Name | CID 89193548 |
|---|---|
| PubChem CID | 89193548 |
| Molecular Formula | C16H14BClFNO2 |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CCNC(=O)c2cc(Cl)ccc2OC)c(F)c1 |
| InChI | InChI=1S/C16H14BClFNO2/c1-22-15-5-4-12(18)9-13(15)16(21)20-7-6-10-2-3-11(17)8-14(10)19/h2-5,8-9H,6-7H2,1H3,(H,20,21) |
| InChIKey | BADUFIWOTSMBDU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|