C20H21ClF3N3O5S2 — CID 23553792
5-chloro-2-methoxy-N-[2-[3-(methylcarbamothioylsulfamoyl)-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]benzamide (PubChem CID 23553792) has the molecular formula C20H21ClF3N3O5S2 and a molecular weight of 539.99 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[2-[3-(methylcarbamothioylsulfamoyl)-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[2-[3-(methylcarbamothioylsulfamoyl)-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 23553792 |
| Molecular Formula | C20H21ClF3N3O5S2 |
| Molecular Weight | 539.99 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | 5-chloro-2-methoxy-N-[2-[3-(methylcarbamothioylsulfamoyl)-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]benzamide |
| SMILES | CNC(=S)NS(=O)(=O)c1cc(CCNC(=O)c2cc(Cl)ccc2OC)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C20H21ClF3N3O5S2/c1-25-19(33)27-34(29,30)17-9-12(3-5-16(17)32-11-20(22,23)24)7-8-26-18(28)14-10-13(21)4-6-15(14)31-2/h3-6,9-10H,7-8,11H2,1-2H3,(H,26,28)(H2,25,27,33) |
| InChIKey | BUBTZYUGGSEZFL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.99 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|