C19H21ClN3NaO5S2 — CID 23697157
sodium (5-chloro-2-methoxybenzoyl)-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]azanide (PubChem CID 23697157) has the molecular formula C19H21ClN3NaO5S2 and a molecular weight of 493.97 g/mol. Its IUPAC name is sodium (5-chloro-2-methoxybenzoyl)-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]azanide.
| Compound Name | sodium (5-chloro-2-methoxybenzoyl)-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]azanide |
|---|---|
| PubChem CID | 23697157 |
| Molecular Formula | C19H21ClN3NaO5S2 |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | sodium (5-chloro-2-methoxybenzoyl)-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]azanide |
| SMILES | CNC(=S)NS(=O)(=O)c1cc(CC[N-]C(=O)c2cc(Cl)ccc2OC)ccc1OC.[Na+] |
| InChI | InChI=1S/C19H22ClN3O5S2.Na/c1-21-19(29)23-30(25,26)17-10-12(4-6-16(17)28-3)8-9-22-18(24)14-11-13(20)5-7-15(14)27-2;/h4-7,10-11H,8-9H2,1-3H3,(H3,21,22,23,24,29);/q;+1/p-1 |
| InChIKey | SUEVHDKFEXAKAF-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|