C22H27N3O4S2 — CID 15390628
2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[(1-phenylcyclobutyl)methyl]acetamide (PubChem CID 15390628) has the molecular formula C22H27N3O4S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[(1-phenylcyclobutyl)methyl]acetamide.
| Compound Name | 2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[(1-phenylcyclobutyl)methyl]acetamide |
|---|---|
| PubChem CID | 15390628 |
| Molecular Formula | C22H27N3O4S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[(1-phenylcyclobutyl)methyl]acetamide |
| SMILES | CNC(=S)NS(=O)(=O)c1cc(CC(=O)NCC2(c3ccccc3)CCC2)ccc1OC |
| InChI | InChI=1S/C22H27N3O4S2/c1-23-21(30)25-31(27,28)19-13-16(9-10-18(19)29-2)14-20(26)24-15-22(11-6-12-22)17-7-4-3-5-8-17/h3-5,7-10,13H,6,11-12,14-15H2,1-2H3,(H,24,26)(H2,23,25,30) |
| InChIKey | HPNXOKBQYWQUDF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|