C18H24N4O4S2 — CID 19971088
2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[2-(1H-pyrrol-2-yl)propan-2-yl]acetamide (PubChem CID 19971088) has the molecular formula C18H24N4O4S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[2-(1H-pyrrol-2-yl)propan-2-yl]acetamide.
| Compound Name | 2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[2-(1H-pyrrol-2-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 19971088 |
| Molecular Formula | C18H24N4O4S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[2-(1H-pyrrol-2-yl)propan-2-yl]acetamide |
| SMILES | CNC(=S)NS(=O)(=O)c1cc(CC(=O)NC(C)(C)c2ccc[nH]2)ccc1OC |
| InChI | InChI=1S/C18H24N4O4S2/c1-18(2,15-6-5-9-20-15)21-16(23)11-12-7-8-13(26-4)14(10-12)28(24,25)22-17(27)19-3/h5-10,20H,11H2,1-4H3,(H,21,23)(H2,19,22,27) |
| InChIKey | QBQRMJDJQLNXNO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|