C19H26N4O4S2 — CID 19971234
2-[4-ethoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[2-(1H-pyrrol-3-yl)propan-2-yl]acetamide (PubChem CID 19971234) has the molecular formula C19H26N4O4S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 2-[4-ethoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[2-(1H-pyrrol-3-yl)propan-2-yl]acetamide.
| Compound Name | 2-[4-ethoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[2-(1H-pyrrol-3-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 19971234 |
| Molecular Formula | C19H26N4O4S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-[4-ethoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-[2-(1H-pyrrol-3-yl)propan-2-yl]acetamide |
| SMILES | CCOc1ccc(CC(=O)NC(C)(C)c2cc[nH]c2)cc1S(=O)(=O)NC(=S)NC |
| InChI | InChI=1S/C19H26N4O4S2/c1-5-27-15-7-6-13(10-16(15)29(25,26)23-18(28)20-4)11-17(24)22-19(2,3)14-8-9-21-12-14/h6-10,12,21H,5,11H2,1-4H3,(H,22,24)(H2,20,23,28) |
| InChIKey | ILDDQSDZNCGKPS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|