C19H25N3O6S — CID 19971142
2-[4-ethoxy-3-(methylcarbamoylsulfamoyl)phenyl]-N-[2-(furan-3-yl)propan-2-yl]acetamide (PubChem CID 19971142) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-[4-ethoxy-3-(methylcarbamoylsulfamoyl)phenyl]-N-[2-(furan-3-yl)propan-2-yl]acetamide.
| Compound Name | 2-[4-ethoxy-3-(methylcarbamoylsulfamoyl)phenyl]-N-[2-(furan-3-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 19971142 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[4-ethoxy-3-(methylcarbamoylsulfamoyl)phenyl]-N-[2-(furan-3-yl)propan-2-yl]acetamide |
| SMILES | CCOc1ccc(CC(=O)NC(C)(C)c2ccoc2)cc1S(=O)(=O)NC(=O)NC |
| InChI | InChI=1S/C19H25N3O6S/c1-5-28-15-7-6-13(10-16(15)29(25,26)22-18(24)20-4)11-17(23)21-19(2,3)14-8-9-27-12-14/h6-10,12H,5,11H2,1-4H3,(H,21,23)(H2,20,22,24) |
| InChIKey | OBTQSQAAYSQIIE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |