C17H21N3O5S2 — CID 19971094
2-[4-methoxy-3-(methylcarbamoylsulfamoyl)phenyl]-N-(1-thiophen-3-ylethyl)acetamide (PubChem CID 19971094) has the molecular formula C17H21N3O5S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-[4-methoxy-3-(methylcarbamoylsulfamoyl)phenyl]-N-(1-thiophen-3-ylethyl)acetamide.
| Compound Name | 2-[4-methoxy-3-(methylcarbamoylsulfamoyl)phenyl]-N-(1-thiophen-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 19971094 |
| Molecular Formula | C17H21N3O5S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-[4-methoxy-3-(methylcarbamoylsulfamoyl)phenyl]-N-(1-thiophen-3-ylethyl)acetamide |
| SMILES | CNC(=O)NS(=O)(=O)c1cc(CC(=O)NC(C)c2ccsc2)ccc1OC |
| InChI | InChI=1S/C17H21N3O5S2/c1-11(13-6-7-26-10-13)19-16(21)9-12-4-5-14(25-3)15(8-12)27(23,24)20-17(22)18-2/h4-8,10-11H,9H2,1-3H3,(H,19,21)(H2,18,20,22) |
| InChIKey | VZDWRXUSGYXZLB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |