C18H23N3O4S3 — CID 19971228
2-[4-ethoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 19971228) has the molecular formula C18H23N3O4S3 and a molecular weight of 441.60 g/mol. Its IUPAC name is 2-[4-ethoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[4-ethoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 19971228 |
| Molecular Formula | C18H23N3O4S3 |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-[4-ethoxy-3-(methylcarbamothioylsulfamoyl)phenyl]-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CCOc1ccc(CC(=O)NC(C)c2cccs2)cc1S(=O)(=O)NC(=S)NC |
| InChI | InChI=1S/C18H23N3O4S3/c1-4-25-14-8-7-13(10-16(14)28(23,24)21-18(26)19-3)11-17(22)20-12(2)15-6-5-9-27-15/h5-10,12H,4,11H2,1-3H3,(H,20,22)(H2,19,21,26) |
| InChIKey | MMEKSCDLWXIIRR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|