C20H28N4O4S2 — CID 19971248
2-[3-(methylcarbamothioylsulfamoyl)-4-propoxyphenyl]-N-[2-(1H-pyrrol-2-yl)propan-2-yl]acetamide (PubChem CID 19971248) has the molecular formula C20H28N4O4S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-[3-(methylcarbamothioylsulfamoyl)-4-propoxyphenyl]-N-[2-(1H-pyrrol-2-yl)propan-2-yl]acetamide.
| Compound Name | 2-[3-(methylcarbamothioylsulfamoyl)-4-propoxyphenyl]-N-[2-(1H-pyrrol-2-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 19971248 |
| Molecular Formula | C20H28N4O4S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-[3-(methylcarbamothioylsulfamoyl)-4-propoxyphenyl]-N-[2-(1H-pyrrol-2-yl)propan-2-yl]acetamide |
| SMILES | CCCOc1ccc(CC(=O)NC(C)(C)c2ccc[nH]2)cc1S(=O)(=O)NC(=S)NC |
| InChI | InChI=1S/C20H28N4O4S2/c1-5-11-28-15-9-8-14(12-16(15)30(26,27)24-19(29)21-4)13-18(25)23-20(2,3)17-7-6-10-22-17/h6-10,12,22H,5,11,13H2,1-4H3,(H,23,25)(H2,21,24,29) |
| InChIKey | MRBQPDDIYQSGBP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|