C24H33N3O5S2 — CID 18474351
5-tert-butyl-2-methoxy-N-[1-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]propan-2-yl]benzamide (PubChem CID 18474351) has the molecular formula C24H33N3O5S2 and a molecular weight of 507.68 g/mol. Its IUPAC name is 5-tert-butyl-2-methoxy-N-[1-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]propan-2-yl]benzamide.
| Compound Name | 5-tert-butyl-2-methoxy-N-[1-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 18474351 |
| Molecular Formula | C24H33N3O5S2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 5-tert-butyl-2-methoxy-N-[1-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]propan-2-yl]benzamide |
| SMILES | CNC(=S)NS(=O)(=O)c1cc(CC(C)NC(=O)c2cc(C(C)(C)C)ccc2OC)ccc1OC |
| InChI | InChI=1S/C24H33N3O5S2/c1-15(26-22(28)18-14-17(24(2,3)4)9-11-19(18)31-6)12-16-8-10-20(32-7)21(13-16)34(29,30)27-23(33)25-5/h8-11,13-15H,12H2,1-7H3,(H,26,28)(H2,25,27,33) |
| InChIKey | KCSKDWXQGWOZIR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|