C20H31N3O4S2 — CID 154525310
N-[(2S)-heptan-2-yl]-1-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 154525310) has the molecular formula C20H31N3O4S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is N-[(2S)-heptan-2-yl]-1-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-[(2S)-heptan-2-yl]-1-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 154525310 |
| Molecular Formula | C20H31N3O4S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-[(2S)-heptan-2-yl]-1-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | CCCCC[C@H](C)NC(=O)C1(c2ccc(OC)c(S(=O)(=O)NC(=S)NC)c2)CC1 |
| InChI | InChI=1S/C20H31N3O4S2/c1-5-6-7-8-14(2)22-18(24)20(11-12-20)15-9-10-16(27-4)17(13-15)29(25,26)23-19(28)21-3/h9-10,13-14H,5-8,11-12H2,1-4H3,(H,22,24)(H2,21,23,28)/t14-/m0/s1 |
| InChIKey | ZAIOPLFOWBYZQL-AWEZNQCLSA-N |
| XLogP | 2.59 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|