C21H34N3O4S2- — CID 57232793
1-methoxy-4-[2-(octan-2-ylamino)-2-oxoethyl]-2-[propan-2-yl-(sulfinatoamino)carbamothioyl]benzene (PubChem CID 57232793) has the molecular formula C21H34N3O4S2- and a molecular weight of 456.65 g/mol. Its IUPAC name is 1-methoxy-4-[2-(octan-2-ylamino)-2-oxoethyl]-2-[propan-2-yl-(sulfinatoamino)carbamothioyl]benzene.
| Compound Name | 1-methoxy-4-[2-(octan-2-ylamino)-2-oxoethyl]-2-[propan-2-yl-(sulfinatoamino)carbamothioyl]benzene |
|---|---|
| PubChem CID | 57232793 |
| Molecular Formula | C21H34N3O4S2- |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 1-methoxy-4-[2-(octan-2-ylamino)-2-oxoethyl]-2-[propan-2-yl-(sulfinatoamino)carbamothioyl]benzene |
| SMILES | CCCCCCC(C)NC(=O)Cc1ccc(OC)c(C(=S)N(NS(=O)[O-])C(C)C)c1 |
| InChI | InChI=1S/C21H35N3O4S2/c1-6-7-8-9-10-16(4)22-20(25)14-17-11-12-19(28-5)18(13-17)21(29)24(15(2)3)23-30(26)27/h11-13,15-16,23H,6-10,14H2,1-5H3,(H,22,25)(H,26,27)/p-1 |
| InChIKey | DKIYZXVLKUBVCO-UHFFFAOYSA-M |
| XLogP | 3.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|