C18H28F2N2O3 — CID 55505837
1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-heptan-2-yl-1-methylurea (PubChem CID 55505837) has the molecular formula C18H28F2N2O3 and a molecular weight of 358.43 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-heptan-2-yl-1-methylurea.
| Compound Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-heptan-2-yl-1-methylurea |
|---|---|
| PubChem CID | 55505837 |
| Molecular Formula | C18H28F2N2O3 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-heptan-2-yl-1-methylurea |
| SMILES | CCCCCC(C)NC(=O)N(C)Cc1ccc(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C18H28F2N2O3/c1-5-6-7-8-13(2)21-18(23)22(3)12-14-9-10-15(25-17(19)20)16(11-14)24-4/h9-11,13,17H,5-8,12H2,1-4H3,(H,21,23) |
| InChIKey | CLXIYCOVSACZDQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|