C21H35N3O5S — CID 55589985
4-(2,5-dimethoxyphenyl)sulfonyl-N-octan-2-ylpiperazine-1-carboxamide (PubChem CID 55589985) has the molecular formula C21H35N3O5S and a molecular weight of 441.59 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)sulfonyl-N-octan-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-(2,5-dimethoxyphenyl)sulfonyl-N-octan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 55589985 |
| Molecular Formula | C21H35N3O5S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)sulfonyl-N-octan-2-ylpiperazine-1-carboxamide |
| SMILES | CCCCCCC(C)NC(=O)N1CCN(S(=O)(=O)c2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C21H35N3O5S/c1-5-6-7-8-9-17(2)22-21(25)23-12-14-24(15-13-23)30(26,27)20-16-18(28-3)10-11-19(20)29-4/h10-11,16-17H,5-9,12-15H2,1-4H3,(H,22,25) |
| InChIKey | KKQUWFBTMUNPQX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|