C19H28N4O4S3 — CID 19971063
2-[3-(methylcarbamothioylsulfamoyl)-4-propoxyphenyl]-N-[2-(2H-1,3-thiazol-3-yl)propan-2-yl]acetamide (PubChem CID 19971063) has the molecular formula C19H28N4O4S3 and a molecular weight of 472.66 g/mol. Its IUPAC name is 2-[3-(methylcarbamothioylsulfamoyl)-4-propoxyphenyl]-N-[2-(2H-1,3-thiazol-3-yl)propan-2-yl]acetamide.
| Compound Name | 2-[3-(methylcarbamothioylsulfamoyl)-4-propoxyphenyl]-N-[2-(2H-1,3-thiazol-3-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 19971063 |
| Molecular Formula | C19H28N4O4S3 |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-[3-(methylcarbamothioylsulfamoyl)-4-propoxyphenyl]-N-[2-(2H-1,3-thiazol-3-yl)propan-2-yl]acetamide |
| SMILES | CCCOc1ccc(CC(=O)NC(C)(C)N2C=CSC2)cc1S(=O)(=O)NC(=S)NC |
| InChI | InChI=1S/C19H28N4O4S3/c1-5-9-27-15-7-6-14(11-16(15)30(25,26)22-18(28)20-4)12-17(24)21-19(2,3)23-8-10-29-13-23/h6-8,10-11H,5,9,12-13H2,1-4H3,(H,21,24)(H2,20,22,28) |
| InChIKey | RINWAFBXSOBXAU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|