C25H25ClFN3O4S — CID 54067863
5-chloro-N-[2-[3-(dimethylaminomethylideneamino)sulfonyl-4-(4-fluorophenyl)phenyl]ethyl]-2-methoxybenzamide (PubChem CID 54067863) has the molecular formula C25H25ClFN3O4S and a molecular weight of 518.01 g/mol. Its IUPAC name is 5-chloro-N-[2-[3-(dimethylaminomethylideneamino)sulfonyl-4-(4-fluorophenyl)phenyl]ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-[3-(dimethylaminomethylideneamino)sulfonyl-4-(4-fluorophenyl)phenyl]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 54067863 |
| Molecular Formula | C25H25ClFN3O4S |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 5-chloro-N-[2-[3-(dimethylaminomethylideneamino)sulfonyl-4-(4-fluorophenyl)phenyl]ethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCc1ccc(-c2ccc(F)cc2)c(S(=O)(=O)N=CN(C)C)c1 |
| InChI | InChI=1S/C25H25ClFN3O4S/c1-30(2)16-29-35(32,33)24-14-17(4-10-21(24)18-5-8-20(27)9-6-18)12-13-28-25(31)22-15-19(26)7-11-23(22)34-3/h4-11,14-16H,12-13H2,1-3H3,(H,28,31) |
| InChIKey | MEHVUBPSNULSBF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|