C11H8Cl2N2O4S — CID 8616857
N'-(2,5-dichlorophenyl)sulfonylfuran-2-carbohydrazide (PubChem CID 8616857) has the molecular formula C11H8Cl2N2O4S and a molecular weight of 335.17 g/mol. Its IUPAC name is N'-(2,5-dichlorophenyl)sulfonylfuran-2-carbohydrazide.
| Compound Name | N'-(2,5-dichlorophenyl)sulfonylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 8616857 |
| Molecular Formula | C11H8Cl2N2O4S |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | N'-(2,5-dichlorophenyl)sulfonylfuran-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cc(Cl)ccc1Cl)c1ccco1 |
| InChI | InChI=1S/C11H8Cl2N2O4S/c12-7-3-4-8(13)10(6-7)20(17,18)15-14-11(16)9-2-1-5-19-9/h1-6,15H,(H,14,16) |
| InChIKey | OQZSEUPPHJQOKU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|