C13H12N2O6S — CID 24502103
3-[(furan-2-carbonylamino)sulfamoyl]-4-methylbenzoic acid (PubChem CID 24502103) has the molecular formula C13H12N2O6S and a molecular weight of 324.31 g/mol. Its IUPAC name is 3-[(furan-2-carbonylamino)sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[(furan-2-carbonylamino)sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 24502103 |
| Molecular Formula | C13H12N2O6S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 3-[(furan-2-carbonylamino)sulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C13H12N2O6S/c1-8-4-5-9(13(17)18)7-11(8)22(19,20)15-14-12(16)10-3-2-6-21-10/h2-7,15H,1H3,(H,14,16)(H,17,18) |
| InChIKey | QYJWGLXRKZUFQZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|