C17H12Cl2N2O5S2 — CID 11561635
3-[[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]sulfamoyl]-4-methylbenzoic acid (PubChem CID 11561635) has the molecular formula C17H12Cl2N2O5S2 and a molecular weight of 459.33 g/mol. Its IUPAC name is 3-[[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 11561635 |
| Molecular Formula | C17H12Cl2N2O5S2 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | 3-[[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]sulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)NNC(=O)c1sc2ccc(Cl)cc2c1Cl |
| InChI | InChI=1S/C17H12Cl2N2O5S2/c1-8-2-3-9(17(23)24)6-13(8)28(25,26)21-20-16(22)15-14(19)11-7-10(18)4-5-12(11)27-15/h2-7,21H,1H3,(H,20,22)(H,23,24) |
| InChIKey | HPMITESRHGHAHA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|