C15H14Cl2N2O3S — CID 1055767
2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-methylphenyl)acetamide (PubChem CID 1055767) has the molecular formula C15H14Cl2N2O3S and a molecular weight of 373.26 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 1055767 |
| Molecular Formula | C15H14Cl2N2O3S |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CNS(=O)(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O3S/c1-10-3-2-4-12(7-10)19-15(20)9-18-23(21,22)14-8-11(16)5-6-13(14)17/h2-8,18H,9H2,1H3,(H,19,20) |
| InChIKey | XBMXYYSJHSXXTC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |