C12H12N2O5 — CID 83192489
2-hydroxy-5-[(5-oxopyrrolidine-3-carbonyl)amino]benzoic acid (PubChem CID 83192489) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-hydroxy-5-[(5-oxopyrrolidine-3-carbonyl)amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[(5-oxopyrrolidine-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 83192489 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-hydroxy-5-[(5-oxopyrrolidine-3-carbonyl)amino]benzoic acid |
| SMILES | O=C1CC(C(=O)Nc2ccc(O)c(C(=O)O)c2)CN1 |
| InChI | InChI=1S/C12H12N2O5/c15-9-2-1-7(4-8(9)12(18)19)14-11(17)6-3-10(16)13-5-6/h1-2,4,6,15H,3,5H2,(H,13,16)(H,14,17)(H,18,19) |
| InChIKey | AOJURQLMCDDVFH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|