C11H13ClN2OS — CID 43122672
N-(2-chloro-4-methylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43122672) has the molecular formula C11H13ClN2OS and a molecular weight of 256.76 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43122672 |
| Molecular Formula | C11H13ClN2OS |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CSCN2)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClN2OS/c1-7-2-3-9(8(12)4-7)14-11(15)10-5-16-6-13-10/h2-4,10,13H,5-6H2,1H3,(H,14,15) |
| InChIKey | HQFRIEKZMMBTLV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |