C13H17FN2O3S — CID 102777994
N-(2-fluoro-5-methylsulfonylphenyl)-3-methylpyrrolidine-2-carboxamide (PubChem CID 102777994) has the molecular formula C13H17FN2O3S and a molecular weight of 300.36 g/mol. Its IUPAC name is N-(2-fluoro-5-methylsulfonylphenyl)-3-methylpyrrolidine-2-carboxamide.
| Compound Name | N-(2-fluoro-5-methylsulfonylphenyl)-3-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 102777994 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-(2-fluoro-5-methylsulfonylphenyl)-3-methylpyrrolidine-2-carboxamide |
| SMILES | CC1CCNC1C(=O)Nc1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C13H17FN2O3S/c1-8-5-6-15-12(8)13(17)16-11-7-9(20(2,18)19)3-4-10(11)14/h3-4,7-8,12,15H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | ZTNCXXUNUYZLES-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |