C13H15ClN2O3S — CID 82906504
methyl 4-chloro-2-(thiomorpholine-3-carbonylamino)benzoate (PubChem CID 82906504) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is methyl 4-chloro-2-(thiomorpholine-3-carbonylamino)benzoate.
| Compound Name | methyl 4-chloro-2-(thiomorpholine-3-carbonylamino)benzoate |
|---|---|
| PubChem CID | 82906504 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | methyl 4-chloro-2-(thiomorpholine-3-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1NC(=O)C1CSCCN1 |
| InChI | InChI=1S/C13H15ClN2O3S/c1-19-13(18)9-3-2-8(14)6-10(9)16-12(17)11-7-20-5-4-15-11/h2-3,6,11,15H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | WXTAQDWFWCYWNZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |