C13H15ClN2O3 — CID 66680324
methyl 5-chloro-2-[[(2R)-pyrrolidine-2-carbonyl]amino]benzoate (PubChem CID 66680324) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is methyl 5-chloro-2-[[(2R)-pyrrolidine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 5-chloro-2-[[(2R)-pyrrolidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 66680324 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | methyl 5-chloro-2-[[(2R)-pyrrolidine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1NC(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C13H15ClN2O3/c1-19-13(18)9-7-8(14)4-5-10(9)16-12(17)11-3-2-6-15-11/h4-5,7,11,15H,2-3,6H2,1H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | WRVXQFIMJAMRJE-LLVKDONJSA-N |
| XLogP | 1.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |