C14H18ClN5O2 — CID 146033506
N-[4-chloro-2-(diaminomethylidenecarbamoyl)phenyl]piperidine-2-carboxamide (PubChem CID 146033506) has the molecular formula C14H18ClN5O2 and a molecular weight of 323.78 g/mol. Its IUPAC name is N-[4-chloro-2-(diaminomethylidenecarbamoyl)phenyl]piperidine-2-carboxamide.
| Compound Name | N-[4-chloro-2-(diaminomethylidenecarbamoyl)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 146033506 |
| Molecular Formula | C14H18ClN5O2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[4-chloro-2-(diaminomethylidenecarbamoyl)phenyl]piperidine-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1cc(Cl)ccc1NC(=O)C1CCCCN1 |
| InChI | InChI=1S/C14H18ClN5O2/c15-8-4-5-10(9(7-8)12(21)20-14(16)17)19-13(22)11-3-1-2-6-18-11/h4-5,7,11,18H,1-3,6H2,(H,19,22)(H4,16,17,20,21) |
| InChIKey | PNJIOHUXTROMAU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|