C12H10F2N2O5 — CID 71940867
methyl 2,4-difluoro-5-[(2-nitrocyclopropanecarbonyl)amino]benzoate (PubChem CID 71940867) has the molecular formula C12H10F2N2O5 and a molecular weight of 300.22 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-[(2-nitrocyclopropanecarbonyl)amino]benzoate.
| Compound Name | methyl 2,4-difluoro-5-[(2-nitrocyclopropanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 71940867 |
| Molecular Formula | C12H10F2N2O5 |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | methyl 2,4-difluoro-5-[(2-nitrocyclopropanecarbonyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)C2CC2[N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C12H10F2N2O5/c1-21-12(18)5-2-9(8(14)4-7(5)13)15-11(17)6-3-10(6)16(19)20/h2,4,6,10H,3H2,1H3,(H,15,17) |
| InChIKey | COKTYXHKPZOBLT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|