C13H16F2N2O2 — CID 79461119
methyl 5-[(3-aminocyclopentyl)amino]-2,4-difluorobenzoate (PubChem CID 79461119) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 5-[(3-aminocyclopentyl)amino]-2,4-difluorobenzoate.
| Compound Name | methyl 5-[(3-aminocyclopentyl)amino]-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 79461119 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | methyl 5-[(3-aminocyclopentyl)amino]-2,4-difluorobenzoate |
| SMILES | COC(=O)c1cc(NC2CCC(N)C2)c(F)cc1F |
| InChI | InChI=1S/C13H16F2N2O2/c1-19-13(18)9-5-12(11(15)6-10(9)14)17-8-3-2-7(16)4-8/h5-8,17H,2-4,16H2,1H3 |
| InChIKey | QPILWLDXDIGXSW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |