C15H19F2NO2 — CID 43731418
methyl 2,4-difluoro-5-[(3-methylcyclohexyl)amino]benzoate (PubChem CID 43731418) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-[(3-methylcyclohexyl)amino]benzoate.
| Compound Name | methyl 2,4-difluoro-5-[(3-methylcyclohexyl)amino]benzoate |
|---|---|
| PubChem CID | 43731418 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | methyl 2,4-difluoro-5-[(3-methylcyclohexyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC2CCCC(C)C2)c(F)cc1F |
| InChI | InChI=1S/C15H19F2NO2/c1-9-4-3-5-10(6-9)18-14-7-11(15(19)20-2)12(16)8-13(14)17/h7-10,18H,3-6H2,1-2H3 |
| InChIKey | QQEIGEAUIRWPIL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |