C11H16N4O5S — CID 64527275
3-[(1-methylsulfonylpiperidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64527275) has the molecular formula C11H16N4O5S and a molecular weight of 316.34 g/mol. Its IUPAC name is 3-[(1-methylsulfonylpiperidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[(1-methylsulfonylpiperidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64527275 |
| Molecular Formula | C11H16N4O5S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-[(1-methylsulfonylpiperidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | CS(=O)(=O)N1CCCCC1C(=O)Nc1cc(C(=O)O)[nH]n1 |
| InChI | InChI=1S/C11H16N4O5S/c1-21(19,20)15-5-3-2-4-8(15)10(16)12-9-6-7(11(17)18)13-14-9/h6,8H,2-5H2,1H3,(H,17,18)(H2,12,13,14,16) |
| InChIKey | IBSUQEZZKOQDBU-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |