C5H7N3O4S — CID 64527301
3-(methanesulfonamido)-1H-pyrazole-5-carboxylic acid (PubChem CID 64527301) has the molecular formula C5H7N3O4S and a molecular weight of 205.19 g/mol. Its IUPAC name is 3-(methanesulfonamido)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(methanesulfonamido)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64527301 |
| Molecular Formula | C5H7N3O4S |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 3-(methanesulfonamido)-1H-pyrazole-5-carboxylic acid |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)O)[nH]n1 |
| InChI | InChI=1S/C5H7N3O4S/c1-13(11,12)8-4-2-3(5(9)10)6-7-4/h2H,1H3,(H,9,10)(H2,6,7,8) |
| InChIKey | XLAQFHUQEKXLRH-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |