About 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid
3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64528474) has the molecular formula C11H18N4O4S
and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid |
| PubChem CID | 64528474 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid |
| SMILES | CC1CC(C)CN(S(=O)(=O)Nc2cc(C(=O)O)[nH]n2)C1 |
| InChI | InChI=1S/C11H18N4O4S/c1-7-3-8(2)6-15(5-7)20(18,19)14-10-4-9(11(16)17)12-13-10/h4,7-8H,3,5-6H2,1-2H3,(H,16,17)(H2,12,13,14) |
| InChIKey | GKDYNZBRRDEHDM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid (CID 64528474) is 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid is CC1CC(C)CN(S(=O)(=O)Nc2cc(C(=O)O)[nH]n2)C1.
What is the InChIKey of 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid?
The InChIKey is GKDYNZBRRDEHDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O4S/c1-7-3-8(2)6-15(5-7)20(18,19)14-10-4-9(11(16)17)12-13-10/h4,7-8H,3,5-6H2,1-2H3,(H,16,17)(H2,12,13,14).
What are the key properties of 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid?
3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid has a molecular weight of 302.36 g/mol, XLogP of 0.74, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethylpiperidin-1-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 64528474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).