C10H7Cl2N3O4S — CID 64527691
3-[(3,5-dichlorophenyl)sulfonylamino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64527691) has the molecular formula C10H7Cl2N3O4S and a molecular weight of 336.16 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenyl)sulfonylamino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[(3,5-dichlorophenyl)sulfonylamino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64527691 |
| Molecular Formula | C10H7Cl2N3O4S |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | 3-[(3,5-dichlorophenyl)sulfonylamino]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2cc(Cl)cc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C10H7Cl2N3O4S/c11-5-1-6(12)3-7(2-5)20(18,19)15-9-4-8(10(16)17)13-14-9/h1-4H,(H,16,17)(H2,13,14,15) |
| InChIKey | RMZXFJVNQGHAAW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |