3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid

C10H15N3O3 — CID 64528256

IUPAC3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid
SMILESCC(C)C(C)C(=O)Nc1cc(C(=O)O)[nH]n1
InChIInChI=1S/C10H15N3O3/c1-5(2)6(3)9(14)11-8-4-7(10(15)16)12-13-8/h4-6H,1-3H3,(H,15,16)(H2,11,12,13,14)
InChIKeyXETKXACIPYMXNG-UHFFFAOYSA-N
MW225.25 g/mol
LogP1.34
Rot. Bonds4

About 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid

3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid (PubChem CID 64528256) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid
PubChem CID64528256
Molecular FormulaC10H15N3O3
Molecular Weight225.25 g/mol
Exact Mass225.11
IUPAC Name3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid
SMILESCC(C)C(C)C(=O)Nc1cc(C(=O)O)[nH]n1
InChIInChI=1S/C10H15N3O3/c1-5(2)6(3)9(14)11-8-4-7(10(15)16)12-13-8/h4-6H,1-3H3,(H,15,16)(H2,11,12,13,14)
InChIKeyXETKXACIPYMXNG-UHFFFAOYSA-N
XLogP1.34
TPSA95.08 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 51.34
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid (CID 64528256) is 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid is CC(C)C(C)C(=O)Nc1cc(C(=O)O)[nH]n1.
What is the InChIKey of 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid?
The InChIKey is XETKXACIPYMXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-5(2)6(3)9(14)11-8-4-7(10(15)16)12-13-8/h4-6H,1-3H3,(H,15,16)(H2,11,12,13,14).
What are the key properties of 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid?
3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid has a molecular weight of 225.25 g/mol, XLogP of 1.34, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 64528256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).