C10H15N3O3 — CID 64528256
3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid (PubChem CID 64528256) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64528256 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-(2,3-dimethylbutanoylamino)-1H-pyrazole-5-carboxylic acid |
| SMILES | CC(C)C(C)C(=O)Nc1cc(C(=O)O)[nH]n1 |
| InChI | InChI=1S/C10H15N3O3/c1-5(2)6(3)9(14)11-8-4-7(10(15)16)12-13-8/h4-6H,1-3H3,(H,15,16)(H2,11,12,13,14) |
| InChIKey | XETKXACIPYMXNG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |