C8H9N3O3 — CID 77043005
3-(but-2-enoylamino)-1H-pyrazole-5-carboxylic acid (PubChem CID 77043005) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is 3-(but-2-enoylamino)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(but-2-enoylamino)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 77043005 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3-(but-2-enoylamino)-1H-pyrazole-5-carboxylic acid |
| SMILES | CC=CC(=O)Nc1cc(C(=O)O)[nH]n1 |
| InChI | InChI=1S/C8H9N3O3/c1-2-3-7(12)9-6-4-5(8(13)14)10-11-6/h2-4H,1H3,(H,13,14)(H2,9,10,11,12) |
| InChIKey | DYWUPXRTSLYRCT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|